C6H16LiN2O4P — CID 175212198
lithium;ethane-1,2-diamine;2-oxido-1,3,2λ5-dioxaphosphepane 2-oxide (PubChem CID 175212198) has the molecular formula C6H16LiN2O4P and a molecular weight of 218.12 g/mol. Its IUPAC name is lithium;ethane-1,2-diamine;2-oxido-1,3,2λ5-dioxaphosphepane 2-oxide.
| Compound Name | lithium;ethane-1,2-diamine;2-oxido-1,3,2λ5-dioxaphosphepane 2-oxide |
|---|---|
| PubChem CID | 175212198 |
| Molecular Formula | C6H16LiN2O4P |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | lithium;ethane-1,2-diamine;2-oxido-1,3,2λ5-dioxaphosphepane 2-oxide |
| SMILES | NCCN.O=P1([O-])OCCCCO1.[Li+] |
| InChI | InChI=1S/C4H9O4P.C2H8N2.Li/c5-9(6)7-3-1-2-4-8-9;3-1-2-4;/h1-4H2,(H,5,6);1-4H2;/q;;+1/p-1 |
| InChIKey | DOCMARZYONJZIU-UHFFFAOYSA-M |
| XLogP | -3.81 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|