About 2-cyclobutyl-3,3-difluoroazepine;hydrochloride
2-cyclobutyl-3,3-difluoroazepine;hydrochloride (PubChem CID 175212819) has the molecular formula C10H12ClF2N
and a molecular weight of 219.66 g/mol. Its IUPAC name is 2-cyclobutyl-3,3-difluoroazepine;hydrochloride.
Molecular Properties
| Compound Name | 2-cyclobutyl-3,3-difluoroazepine;hydrochloride |
| PubChem CID | 175212819 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-cyclobutyl-3,3-difluoroazepine;hydrochloride |
| SMILES | Cl.FC1(F)C=CC=CN=C1C1CCC1 |
| InChI | InChI=1S/C10H11F2N.ClH/c11-10(12)6-1-2-7-13-9(10)8-4-3-5-8;/h1-2,6-8H,3-5H2;1H |
| InChIKey | AYQUQANJYCDMDQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclobutyl-3,3-difluoroazepine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-3,3-difluoroazepine;hydrochloride?
The IUPAC name of 2-cyclobutyl-3,3-difluoroazepine;hydrochloride (CID 175212819) is 2-cyclobutyl-3,3-difluoroazepine;hydrochloride.
What is the SMILES notation for 2-cyclobutyl-3,3-difluoroazepine;hydrochloride?
The canonical SMILES for 2-cyclobutyl-3,3-difluoroazepine;hydrochloride is Cl.FC1(F)C=CC=CN=C1C1CCC1.
What is the InChIKey of 2-cyclobutyl-3,3-difluoroazepine;hydrochloride?
The InChIKey is AYQUQANJYCDMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N.ClH/c11-10(12)6-1-2-7-13-9(10)8-4-3-5-8;/h1-2,6-8H,3-5H2;1H.
What are the key properties of 2-cyclobutyl-3,3-difluoroazepine;hydrochloride?
2-cyclobutyl-3,3-difluoroazepine;hydrochloride has a molecular weight of 219.66 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-3,3-difluoroazepine;hydrochloride is sourced from PubChem (CID 175212819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).