About [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate
[2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate (PubChem CID 175213123) has the molecular formula C13H20N2O3S2
and a molecular weight of 316.45 g/mol. Its IUPAC name is [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate.
Molecular Properties
| Compound Name | [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate |
| PubChem CID | 175213123 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate |
| SMILES | CC(COC(N)=O)(C(S)S)C(N)c1ccc(CO)cc1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-13(11(19)20,7-18-12(15)17)10(14)9-4-2-8(6-16)3-5-9/h2-5,10-11,16,19-20H,6-7,14H2,1H3,(H2,15,17) |
| InChIKey | HUZNVSZASPTWMX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate?
The IUPAC name of [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate (CID 175213123) is [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate.
What is the SMILES notation for [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate?
The canonical SMILES for [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate is CC(COC(N)=O)(C(S)S)C(N)c1ccc(CO)cc1.
What is the InChIKey of [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate?
The InChIKey is HUZNVSZASPTWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3S2/c1-13(11(19)20,7-18-12(15)17)10(14)9-4-2-8(6-16)3-5-9/h2-5,10-11,16,19-20H,6-7,14H2,1H3,(H2,15,17).
What are the key properties of [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate?
[2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate has a molecular weight of 316.45 g/mol, XLogP of 1.47, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[amino-[4-(hydroxymethyl)phenyl]methyl]-2-methyl-3,3-bis(sulfanyl)propyl] carbamate is sourced from PubChem (CID 175213123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).