About 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid
7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid (PubChem CID 175213163) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid |
| PubChem CID | 175213163 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)OC(C(=O)O)CC2=O |
| InChI | InChI=1S/C14H16O4/c1-14(2,3)8-4-5-9-10(15)7-12(13(16)17)18-11(9)6-8/h4-6,12H,7H2,1-3H3,(H,16,17) |
| InChIKey | VUDARWSBUHIZSJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid?
The IUPAC name of 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid (CID 175213163) is 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid.
What is the SMILES notation for 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid?
The canonical SMILES for 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid is CC(C)(C)c1ccc2c(c1)OC(C(=O)O)CC2=O.
What is the InChIKey of 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid?
The InChIKey is VUDARWSBUHIZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-14(2,3)8-4-5-9-10(15)7-12(13(16)17)18-11(9)6-8/h4-6,12H,7H2,1-3H3,(H,16,17).
What are the key properties of 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid?
7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid has a molecular weight of 248.28 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4-oxo-2,3-dihydrochromene-2-carboxylic acid is sourced from PubChem (CID 175213163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).