C24H34O11 — CID 175213746
3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propanoic acid (PubChem CID 175213746) has the molecular formula C24H34O11 and a molecular weight of 498.53 g/mol. Its IUPAC name is 3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propanoic acid.
| Compound Name | 3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propanoic acid |
|---|---|
| PubChem CID | 175213746 |
| Molecular Formula | C24H34O11 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(CC(OC(=O)OC(C)(C)C)C(=O)O)cc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H34O11/c1-22(2,3)33-19(27)30-15-11-10-14(12-16(15)31-20(28)34-23(4,5)6)13-17(18(25)26)32-21(29)35-24(7,8)9/h10-12,17H,13H2,1-9H3,(H,25,26) |
| InChIKey | SJFDTNLPTKLPFE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|