About azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine
azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine (PubChem CID 175213889) has the molecular formula C12H10ClF3N6
and a molecular weight of 330.70 g/mol. Its IUPAC name is azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine.
Molecular Properties
| Compound Name | azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine |
| PubChem CID | 175213889 |
| Molecular Formula | C12H10ClF3N6 |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine |
| SMILES | N.Nc1ccc2c(cnn2-c2nc(Cl)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7ClF3N5.H3N/c13-11-18-5-8(12(14,15)16)10(20-11)21-9-2-1-7(17)3-6(9)4-19-21;/h1-5H,17H2;1H3 |
| InChIKey | GNDMJYNDDFCWCZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine?
The IUPAC name of azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine (CID 175213889) is azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine.
What is the SMILES notation for azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine?
The canonical SMILES for azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine is N.Nc1ccc2c(cnn2-c2nc(Cl)ncc2C(F)(F)F)c1.
What is the InChIKey of azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine?
The InChIKey is GNDMJYNDDFCWCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClF3N5.H3N/c13-11-18-5-8(12(14,15)16)10(20-11)21-9-2-1-7(17)3-6(9)4-19-21;/h1-5H,17H2;1H3.
What are the key properties of azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine?
azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine has a molecular weight of 330.70 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]indazol-5-amine is sourced from PubChem (CID 175213889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).