C28H32F2N4O7S — CID 175214998
tert-butyl-[[(1S,2R)-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-3-oxopropyl]amino]-oxidosulfanium (PubChem CID 175214998) has the molecular formula C28H32F2N4O7S and a molecular weight of 606.65 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R)-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-3-oxopropyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S,2R)-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-3-oxopropyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175214998 |
| Molecular Formula | C28H32F2N4O7S |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | tert-butyl-[[(1S,2R)-2-fluoro-1-[2-fluoro-5-[(6-methyl-3-pyridinyl)oxy]phenyl]-3-[1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-3-oxopropyl]amino]-oxidosulfanium |
| SMILES | Cc1ccc(Oc2ccc(F)c([C@H](N[S+]([O-])C(C)(C)C)[C@@H](F)C(=O)C3C(=O)NC(=O)N(C4CCOCC4)C3=O)c2)cn1 |
| InChI | InChI=1S/C28H32F2N4O7S/c1-15-5-6-18(14-31-15)41-17-7-8-20(29)19(13-17)23(33-42(39)28(2,3)4)22(30)24(35)21-25(36)32-27(38)34(26(21)37)16-9-11-40-12-10-16/h5-8,13-14,16,21-23,33H,9-12H2,1-4H3,(H,32,36,38)/t21?,22-,23+,42?/m1/s1 |
| InChIKey | SVTSKZRABMLDDF-HKOJGAFDSA-N |
| XLogP | 3.20 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|