C27H37F2N3O7S — CID 175215050
tert-butyl-[[(1S,2S)-2-fluoro-1-[2-fluoro-5-(oxan-4-yloxy)phenyl]-3-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium (PubChem CID 175215050) has the molecular formula C27H37F2N3O7S and a molecular weight of 585.67 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-2-fluoro-1-[2-fluoro-5-(oxan-4-yloxy)phenyl]-3-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S,2S)-2-fluoro-1-[2-fluoro-5-(oxan-4-yloxy)phenyl]-3-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175215050 |
| Molecular Formula | C27H37F2N3O7S |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | tert-butyl-[[(1S,2S)-2-fluoro-1-[2-fluoro-5-(oxan-4-yloxy)phenyl]-3-[(5R)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](c1cc(OC2CCOCC2)ccc1F)[C@@H](F)C[C@@H]1C(=O)NC(=O)N(C2CCOCC2)C1=O |
| InChI | InChI=1S/C27H37F2N3O7S/c1-27(2,3)40(36)31-23(19-14-18(4-5-21(19)28)39-17-8-12-38-13-9-17)22(29)15-20-24(33)30-26(35)32(25(20)34)16-6-10-37-11-7-16/h4-5,14,16-17,20,22-23,31H,6-13,15H2,1-3H3,(H,30,33,35)/t20-,22+,23+,40?/m1/s1 |
| InChIKey | CLMCXSKHECITJT-CSDXXGRWSA-N |
| XLogP | 3.08 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|