C18H15ClFN3OS — CID 175215309
N-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide (PubChem CID 175215309) has the molecular formula C18H15ClFN3OS and a molecular weight of 375.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 175215309 |
| Molecular Formula | C18H15ClFN3OS |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[(3-cyano-6-cyclopropyl-2-pyridinyl)sulfanyl]propanamide |
| SMILES | N#Cc1ccc(C2CC2)nc1SCCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3OS/c19-14-9-13(4-5-15(14)20)22-17(24)7-8-25-18-12(10-21)3-6-16(23-18)11-1-2-11/h3-6,9,11H,1-2,7-8H2,(H,22,24) |
| InChIKey | KPNRHGJTCMHNRR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |