C13H10F15NO3 — CID 175215362
2-methyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)butanoic acid (PubChem CID 175215362) has the molecular formula C13H10F15NO3 and a molecular weight of 513.20 g/mol. Its IUPAC name is 2-methyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)butanoic acid.
| Compound Name | 2-methyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)butanoic acid |
|---|---|
| PubChem CID | 175215362 |
| Molecular Formula | C13H10F15NO3 |
| Molecular Weight | 513.20 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 2-methyl-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)butanoic acid |
| SMILES | CC(CCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H10F15NO3/c1-4(5(30)31)2-3-29-6(32)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h4H,2-3H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | VDECXTFLLCKKDU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|