About 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid
3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid (PubChem CID 175215969) has the molecular formula C6H12FNO5S
and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid.
Molecular Properties
| Compound Name | 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid |
| PubChem CID | 175215969 |
| Molecular Formula | C6H12FNO5S |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=CN1CC(O)C(F)C1 |
| InChI | InChI=1S/C5H8FNO2.CH4O3S/c6-4-1-7(3-8)2-5(4)9;1-5(2,3)4/h3-5,9H,1-2H2;1H3,(H,2,3,4) |
| InChIKey | PKJJJIFIAPPCEO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid?
The IUPAC name of 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid (CID 175215969) is 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid.
What is the SMILES notation for 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid?
The canonical SMILES for 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid is CS(=O)(=O)O.O=CN1CC(O)C(F)C1.
What is the InChIKey of 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid?
The InChIKey is PKJJJIFIAPPCEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO2.CH4O3S/c6-4-1-7(3-8)2-5(4)9;1-5(2,3)4/h3-5,9H,1-2H2;1H3,(H,2,3,4).
What are the key properties of 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid?
3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid has a molecular weight of 229.23 g/mol, XLogP of -1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-hydroxypyrrolidine-1-carbaldehyde;methanesulfonic acid is sourced from PubChem (CID 175215969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).