About trimethyl 5-methylhex-1-en-3-yl silicate
trimethyl 5-methylhex-1-en-3-yl silicate (PubChem CID 175216166) has the molecular formula C10H22O4Si
and a molecular weight of 234.37 g/mol. Its IUPAC name is trimethyl 5-methylhex-1-en-3-yl silicate.
Molecular Properties
| Compound Name | trimethyl 5-methylhex-1-en-3-yl silicate |
| PubChem CID | 175216166 |
| Molecular Formula | C10H22O4Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | trimethyl 5-methylhex-1-en-3-yl silicate |
| SMILES | C=CC(CC(C)C)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H22O4Si/c1-7-10(8-9(2)3)14-15(11-4,12-5)13-6/h7,9-10H,1,8H2,2-6H3 |
| InChIKey | KVPQSQMXQQINAB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl 5-methylhex-1-en-3-yl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl 5-methylhex-1-en-3-yl silicate?
The IUPAC name of trimethyl 5-methylhex-1-en-3-yl silicate (CID 175216166) is trimethyl 5-methylhex-1-en-3-yl silicate.
What is the SMILES notation for trimethyl 5-methylhex-1-en-3-yl silicate?
The canonical SMILES for trimethyl 5-methylhex-1-en-3-yl silicate is C=CC(CC(C)C)O[Si](OC)(OC)OC.
What is the InChIKey of trimethyl 5-methylhex-1-en-3-yl silicate?
The InChIKey is KVPQSQMXQQINAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4Si/c1-7-10(8-9(2)3)14-15(11-4,12-5)13-6/h7,9-10H,1,8H2,2-6H3.
What are the key properties of trimethyl 5-methylhex-1-en-3-yl silicate?
trimethyl 5-methylhex-1-en-3-yl silicate has a molecular weight of 234.37 g/mol, XLogP of 1.98, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl 5-methylhex-1-en-3-yl silicate is sourced from PubChem (CID 175216166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).