C15H22F2N2O4 — CID 175216683
1-(2,2-dimethyl-3-oxo-3-prop-2-enoxypropyl)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 175216683) has the molecular formula C15H22F2N2O4 and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-oxo-3-prop-2-enoxypropyl)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | 1-(2,2-dimethyl-3-oxo-3-prop-2-enoxypropyl)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 175216683 |
| Molecular Formula | C15H22F2N2O4 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-(2,2-dimethyl-3-oxo-3-prop-2-enoxypropyl)-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | C=CCOC(=O)C(C)(C)CN1CCC2C1C(F)(F)CN2C(=O)O |
| InChI | InChI=1S/C15H22F2N2O4/c1-4-7-23-12(20)14(2,3)8-18-6-5-10-11(18)15(16,17)9-19(10)13(21)22/h4,10-11H,1,5-9H2,2-3H3,(H,21,22) |
| InChIKey | JAROOSHIFNCADP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|