C20H15Cl2N5O5 — CID 175217222
carbamoyl 2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-7-yl)oxy]phenyl]hydrazinylidene]acetate (PubChem CID 175217222) has the molecular formula C20H15Cl2N5O5 and a molecular weight of 476.28 g/mol. Its IUPAC name is carbamoyl 2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-7-yl)oxy]phenyl]hydrazinylidene]acetate.
| Compound Name | carbamoyl 2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-7-yl)oxy]phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 175217222 |
| Molecular Formula | C20H15Cl2N5O5 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | carbamoyl 2-cyano-2-[[3,5-dichloro-4-[(1-oxo-2,3,4,5-tetrahydro-2-benzazepin-7-yl)oxy]phenyl]hydrazinylidene]acetate |
| SMILES | N#CC(=NNc1cc(Cl)c(Oc2ccc3c(c2)CCCNC3=O)c(Cl)c1)C(=O)OC(N)=O |
| InChI | InChI=1S/C20H15Cl2N5O5/c21-14-7-11(26-27-16(9-23)19(29)32-20(24)30)8-15(22)17(14)31-12-3-4-13-10(6-12)2-1-5-25-18(13)28/h3-4,6-8,26H,1-2,5H2,(H2,24,30)(H,25,28) |
| InChIKey | DWUZXDMNPGPKMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|