About 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide
3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide (PubChem CID 175217650) has the molecular formula C19H19Cl3N2O
and a molecular weight of 397.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide |
| PubChem CID | 175217650 |
| Molecular Formula | C19H19Cl3N2O |
| Molecular Weight | 397.73 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide |
| SMILES | CCCN(C(=O)c1ncccc1Cl)C1CCC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl3N2O/c1-2-10-24(19(25)18-15(21)4-3-9-23-18)17-8-7-14(17)13-6-5-12(20)11-16(13)22/h3-6,9,11,14,17H,2,7-8,10H2,1H3 |
| InChIKey | WEVHBLGXVOZVCN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide?
The IUPAC name of 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide (CID 175217650) is 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide.
What is the SMILES notation for 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide?
The canonical SMILES for 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide is CCCN(C(=O)c1ncccc1Cl)C1CCC1c1ccc(Cl)cc1Cl.
What is the InChIKey of 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide?
The InChIKey is WEVHBLGXVOZVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl3N2O/c1-2-10-24(19(25)18-15(21)4-3-9-23-18)17-8-7-14(17)13-6-5-12(20)11-16(13)22/h3-6,9,11,14,17H,2,7-8,10H2,1H3.
What are the key properties of 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide?
3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide has a molecular weight of 397.73 g/mol, XLogP of 5.84, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-(2,4-dichlorophenyl)cyclobutyl]-N-propylpyridine-2-carboxamide is sourced from PubChem (CID 175217650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).