About 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol
4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol (PubChem CID 175217725) has the molecular formula C24H34O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol.
Molecular Properties
| Compound Name | 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol |
| PubChem CID | 175217725 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol |
| SMILES | CC(C)c1cc(-c2ccc(O)cc2)c(C(C)C)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C24H34O/c1-14(2)20-13-21(18-9-11-19(25)12-10-18)23(16(5)6)24(17(7)8)22(20)15(3)4/h9-17,25H,1-8H3 |
| InChIKey | HXVJBTXRRLWBJA-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol?
The IUPAC name of 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol (CID 175217725) is 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol.
What is the SMILES notation for 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol?
The canonical SMILES for 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol is CC(C)c1cc(-c2ccc(O)cc2)c(C(C)C)c(C(C)C)c1C(C)C.
What is the InChIKey of 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol?
The InChIKey is HXVJBTXRRLWBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O/c1-14(2)20-13-21(18-9-11-19(25)12-10-18)23(16(5)6)24(17(7)8)22(20)15(3)4/h9-17,25H,1-8H3.
What are the key properties of 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol?
4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol has a molecular weight of 338.54 g/mol, XLogP of 7.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,3,4,5-tetra(propan-2-yl)phenyl]phenol is sourced from PubChem (CID 175217725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).