About 1-azidotetrazol-5-amine;zinc
1-azidotetrazol-5-amine;zinc (PubChem CID 175217844) has the molecular formula CH2N8Zn
and a molecular weight of 191.47 g/mol. Its IUPAC name is 1-azidotetrazol-5-amine;zinc.
Molecular Properties
| Compound Name | 1-azidotetrazol-5-amine;zinc |
| PubChem CID | 175217844 |
| Molecular Formula | CH2N8Zn |
| Molecular Weight | 191.47 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | 1-azidotetrazol-5-amine;zinc |
| SMILES | [N-]=[N+]=Nn1nnnc1N.[Zn] |
| InChI | InChI=1S/CH2N8.Zn/c2-1-4-6-8-9(1)7-5-3;/h(H2,2,4,8); |
| InChIKey | RGAXUSYUAGTSTE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.47 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidotetrazol-5-amine;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidotetrazol-5-amine;zinc?
The IUPAC name of 1-azidotetrazol-5-amine;zinc (CID 175217844) is 1-azidotetrazol-5-amine;zinc.
What is the SMILES notation for 1-azidotetrazol-5-amine;zinc?
The canonical SMILES for 1-azidotetrazol-5-amine;zinc is [N-]=[N+]=Nn1nnnc1N.[Zn].
What is the InChIKey of 1-azidotetrazol-5-amine;zinc?
The InChIKey is RGAXUSYUAGTSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2N8.Zn/c2-1-4-6-8-9(1)7-5-3;/h(H2,2,4,8);.
What are the key properties of 1-azidotetrazol-5-amine;zinc?
1-azidotetrazol-5-amine;zinc has a molecular weight of 191.47 g/mol, XLogP of -0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidotetrazol-5-amine;zinc is sourced from PubChem (CID 175217844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).