About 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid
4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175218350) has the molecular formula C11H19F3N2O6S2
and a molecular weight of 396.41 g/mol. Its IUPAC name is 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid |
| PubChem CID | 175218350 |
| Molecular Formula | C11H19F3N2O6S2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CC(C)n1ccnc1CCC(C)S(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N2O3S.CHF3O3S/c1-8(2)12-7-6-11-10(12)5-4-9(3)16(13,14)15;2-1(3,4)8(5,6)7/h6-9H,4-5H2,1-3H3,(H,13,14,15);(H,5,6,7) |
| InChIKey | XKFAFZLGDMMZGP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid?
The IUPAC name of 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid (CID 175218350) is 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid?
The canonical SMILES for 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid is CC(C)n1ccnc1CCC(C)S(=O)(=O)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid?
The InChIKey is XKFAFZLGDMMZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3S.CHF3O3S/c1-8(2)12-7-6-11-10(12)5-4-9(3)16(13,14)15;2-1(3,4)8(5,6)7/h6-9H,4-5H2,1-3H3,(H,13,14,15);(H,5,6,7).
What are the key properties of 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid?
4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid has a molecular weight of 396.41 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-propan-2-ylimidazol-2-yl)butane-2-sulfonic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 175218350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).