C21H19F4N7O2 — CID 175218358
5-[2-fluoro-6-(trifluoromethyl)anilino]-3-[(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide (PubChem CID 175218358) has the molecular formula C21H19F4N7O2 and a molecular weight of 477.42 g/mol. Its IUPAC name is 5-[2-fluoro-6-(trifluoromethyl)anilino]-3-[(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 5-[2-fluoro-6-(trifluoromethyl)anilino]-3-[(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 175218358 |
| Molecular Formula | C21H19F4N7O2 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-[2-fluoro-6-(trifluoromethyl)anilino]-3-[(6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl)amino]-1,2,4-triazine-6-carboxamide |
| SMILES | COc1cc2c(cc1Nc1nnc(C(N)=O)c(Nc3c(F)cccc3C(F)(F)F)n1)CNCC2 |
| InChI | InChI=1S/C21H19F4N7O2/c1-34-15-8-10-5-6-27-9-11(10)7-14(15)28-20-30-19(17(18(26)33)31-32-20)29-16-12(21(23,24)25)3-2-4-13(16)22/h2-4,7-8,27H,5-6,9H2,1H3,(H2,26,33)(H2,28,29,30,32) |
| InChIKey | YYQVFSDEFQMEHP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |