About 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine
3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine (PubChem CID 175219533) has the molecular formula C8H11ClN2
and a molecular weight of 170.64 g/mol. Its IUPAC name is 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine.
Molecular Properties
| Compound Name | 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine |
| PubChem CID | 175219533 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine |
| SMILES | Clc1cc2cc-2c1.NCCN |
| InChI | InChI=1S/C6H3Cl.C2H8N2/c7-6-2-4-1-5(4)3-6;3-1-2-4/h1-3H;1-4H2 |
| InChIKey | QDIPUYHDQWKVPF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine?
The IUPAC name of 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine (CID 175219533) is 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine.
What is the SMILES notation for 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine?
The canonical SMILES for 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine is Clc1cc2cc-2c1.NCCN.
What is the InChIKey of 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine?
The InChIKey is QDIPUYHDQWKVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl.C2H8N2/c7-6-2-4-1-5(4)3-6;3-1-2-4/h1-3H;1-4H2.
What are the key properties of 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine?
3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine has a molecular weight of 170.64 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobicyclo[3.1.0]hexa-1(6),2,4-triene;ethane-1,2-diamine is sourced from PubChem (CID 175219533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).