About 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid
2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid (PubChem CID 175219647) has the molecular formula C7H8F3N5O2
and a molecular weight of 251.17 g/mol. Its IUPAC name is 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid |
| PubChem CID | 175219647 |
| Molecular Formula | C7H8F3N5O2 |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=Nc1cnccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H7N5.C2HF3O2/c6-5(7)10-4-3-8-1-2-9-4;3-2(4,5)1(6)7/h1-3H,(H4,6,7,9,10);(H,6,7) |
| InChIKey | UHVLOCGHJXHGSS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid (CID 175219647) is 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid is NC(N)=Nc1cnccn1.O=C(O)C(F)(F)F.
What is the InChIKey of 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid?
The InChIKey is UHVLOCGHJXHGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5.C2HF3O2/c6-5(7)10-4-3-8-1-2-9-4;3-2(4,5)1(6)7/h1-3H,(H4,6,7,9,10);(H,6,7).
What are the key properties of 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid?
2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid has a molecular weight of 251.17 g/mol, XLogP of 0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-ylguanidine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175219647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).