C24H32N2O5S — CID 175219910
4-methyl-2-[3-[(4-phenyl-1-prop-2-ynoxycyclohexa-2,4-dien-1-yl)sulfonylamino]propylamino]pentanoic acid (PubChem CID 175219910) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is 4-methyl-2-[3-[(4-phenyl-1-prop-2-ynoxycyclohexa-2,4-dien-1-yl)sulfonylamino]propylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[3-[(4-phenyl-1-prop-2-ynoxycyclohexa-2,4-dien-1-yl)sulfonylamino]propylamino]pentanoic acid |
|---|---|
| PubChem CID | 175219910 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-methyl-2-[3-[(4-phenyl-1-prop-2-ynoxycyclohexa-2,4-dien-1-yl)sulfonylamino]propylamino]pentanoic acid |
| SMILES | C#CCOC1(S(=O)(=O)NCCCNC(CC(C)C)C(=O)O)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C24H32N2O5S/c1-4-17-31-24(13-11-21(12-14-24)20-9-6-5-7-10-20)32(29,30)26-16-8-15-25-22(23(27)28)18-19(2)3/h1,5-7,9-13,19,22,25-26H,8,14-18H2,2-3H3,(H,27,28) |
| InChIKey | LEIPQCMPGMYLSM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|