About 1,3-benzothiazole;propane-2-thiol
1,3-benzothiazole;propane-2-thiol (PubChem CID 175220020) has the molecular formula C10H13NS2
and a molecular weight of 211.36 g/mol. Its IUPAC name is 1,3-benzothiazole;propane-2-thiol.
Molecular Properties
| Compound Name | 1,3-benzothiazole;propane-2-thiol |
| PubChem CID | 175220020 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.36 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 1,3-benzothiazole;propane-2-thiol |
| SMILES | CC(C)S.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.C3H8S/c1-2-4-7-6(3-1)8-5-9-7;1-3(2)4/h1-5H;3-4H,1-2H3 |
| InChIKey | DGKGUDWPIIETBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole;propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;propane-2-thiol?
The IUPAC name of 1,3-benzothiazole;propane-2-thiol (CID 175220020) is 1,3-benzothiazole;propane-2-thiol.
What is the SMILES notation for 1,3-benzothiazole;propane-2-thiol?
The canonical SMILES for 1,3-benzothiazole;propane-2-thiol is CC(C)S.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;propane-2-thiol?
The InChIKey is DGKGUDWPIIETBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS.C3H8S/c1-2-4-7-6(3-1)8-5-9-7;1-3(2)4/h1-5H;3-4H,1-2H3.
What are the key properties of 1,3-benzothiazole;propane-2-thiol?
1,3-benzothiazole;propane-2-thiol has a molecular weight of 211.36 g/mol, XLogP of 3.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;propane-2-thiol is sourced from PubChem (CID 175220020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).