About 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile
3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile (PubChem CID 175220156) has the molecular formula C14H12ClN3O
and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile.
Molecular Properties
| Compound Name | 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile |
| PubChem CID | 175220156 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile |
| SMILES | CCC#N.N#CCC(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C11H7ClN2O.C3H5N/c12-7-1-2-8-9(11(15)3-4-13)6-14-10(8)5-7;1-2-3-4/h1-2,5-6,14H,3H2;2H2,1H3 |
| InChIKey | IONKWHUUZBIFEL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile?
The IUPAC name of 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile (CID 175220156) is 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile.
What is the SMILES notation for 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile?
The canonical SMILES for 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile is CCC#N.N#CCC(=O)c1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile?
The InChIKey is IONKWHUUZBIFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN2O.C3H5N/c12-7-1-2-8-9(11(15)3-4-13)6-14-10(8)5-7;1-2-3-4/h1-2,5-6,14H,3H2;2H2,1H3.
What are the key properties of 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile?
3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile has a molecular weight of 273.72 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-1H-indol-3-yl)-3-oxopropanenitrile;propanenitrile is sourced from PubChem (CID 175220156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).