About [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate
[3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate (PubChem CID 175220422) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate |
| PubChem CID | 175220422 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate |
| SMILES | C=Cc1cc(C=C)c(OC(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C13H17NO2S/c1-6-9-8-10(7-2)17-11(9)16-12(15)14-13(3,4)5/h6-8H,1-2H2,3-5H3,(H,14,15) |
| InChIKey | UVJCAXLJKCZCTE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate?
The IUPAC name of [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate (CID 175220422) is [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate.
What is the SMILES notation for [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate?
The canonical SMILES for [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate is C=Cc1cc(C=C)c(OC(=O)NC(C)(C)C)s1.
What is the InChIKey of [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate?
The InChIKey is UVJCAXLJKCZCTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S/c1-6-9-8-10(7-2)17-11(9)16-12(15)14-13(3,4)5/h6-8H,1-2H2,3-5H3,(H,14,15).
What are the key properties of [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate?
[3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate has a molecular weight of 251.35 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(ethenyl)thiophen-2-yl] N-tert-butylcarbamate is sourced from PubChem (CID 175220422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).