About (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate
(2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate (PubChem CID 175220437) has the molecular formula C12H16BrNO2S
and a molecular weight of 318.24 g/mol. Its IUPAC name is (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate |
| PubChem CID | 175220437 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1cc(C2CC2)sc1Br |
| InChI | InChI=1S/C12H16BrNO2S/c1-12(2,3)14-11(15)16-8-6-9(7-4-5-7)17-10(8)13/h6-7H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | CDXOQFFOVLVXCX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate?
The IUPAC name of (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate (CID 175220437) is (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate.
What is the SMILES notation for (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate?
The canonical SMILES for (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1cc(C2CC2)sc1Br.
What is the InChIKey of (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate?
The InChIKey is CDXOQFFOVLVXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO2S/c1-12(2,3)14-11(15)16-8-6-9(7-4-5-7)17-10(8)13/h6-7H,4-5H2,1-3H3,(H,14,15).
What are the key properties of (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate?
(2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate has a molecular weight of 318.24 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-5-cyclopropylthiophen-3-yl) N-tert-butylcarbamate is sourced from PubChem (CID 175220437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).