C11H17BrN4 — CID 175221367
3-bromo-5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]pyridazine (PubChem CID 175221367) has the molecular formula C11H17BrN4 and a molecular weight of 285.19 g/mol. Its IUPAC name is 3-bromo-5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]pyridazine.
| Compound Name | 3-bromo-5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 175221367 |
| Molecular Formula | C11H17BrN4 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-bromo-5-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]pyridazine |
| SMILES | C[C@@H]1CN(c2cnnc(Br)c2)C[C@H](C)N1C |
| InChI | InChI=1S/C11H17BrN4/c1-8-6-16(7-9(2)15(8)3)10-4-11(12)14-13-5-10/h4-5,8-9H,6-7H2,1-3H3/t8-,9+ |
| InChIKey | FHFWKZNAISAPNR-DTORHVGOSA-N |
| XLogP | 1.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |