C16H20O4Si — CID 175221682
2-[(1R,2S,3R)-3-[dimethyl(phenyl)silyl]-2-formyl-5-oxocyclopentyl]acetic acid (PubChem CID 175221682) has the molecular formula C16H20O4Si and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-3-[dimethyl(phenyl)silyl]-2-formyl-5-oxocyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,3R)-3-[dimethyl(phenyl)silyl]-2-formyl-5-oxocyclopentyl]acetic acid |
|---|---|
| PubChem CID | 175221682 |
| Molecular Formula | C16H20O4Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[(1R,2S,3R)-3-[dimethyl(phenyl)silyl]-2-formyl-5-oxocyclopentyl]acetic acid |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1CC(=O)[C@H](CC(=O)O)[C@H]1C=O |
| InChI | InChI=1S/C16H20O4Si/c1-21(2,11-6-4-3-5-7-11)15-9-14(18)12(8-16(19)20)13(15)10-17/h3-7,10,12-13,15H,8-9H2,1-2H3,(H,19,20)/t12-,13-,15-/m1/s1 |
| InChIKey | LHCVGIDPQQMVIB-UMVBOHGHSA-N |
| XLogP | 1.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|