C13H18BrFN2O3 — CID 175221947
2-[3-bromo-2-(ethylaminomethyl)-4-fluorophenoxy]propyl carbamate (PubChem CID 175221947) has the molecular formula C13H18BrFN2O3 and a molecular weight of 349.20 g/mol. Its IUPAC name is 2-[3-bromo-2-(ethylaminomethyl)-4-fluorophenoxy]propyl carbamate.
| Compound Name | 2-[3-bromo-2-(ethylaminomethyl)-4-fluorophenoxy]propyl carbamate |
|---|---|
| PubChem CID | 175221947 |
| Molecular Formula | C13H18BrFN2O3 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[3-bromo-2-(ethylaminomethyl)-4-fluorophenoxy]propyl carbamate |
| SMILES | CCNCc1c(OC(C)COC(N)=O)ccc(F)c1Br |
| InChI | InChI=1S/C13H18BrFN2O3/c1-3-17-6-9-11(5-4-10(15)12(9)14)20-8(2)7-19-13(16)18/h4-5,8,17H,3,6-7H2,1-2H3,(H2,16,18) |
| InChIKey | HZHGDWSIGZJBDG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |