C31H32N2O12S3 — CID 175222302
[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-methylthiophene-2-sulfonate (PubChem CID 175222302) has the molecular formula C31H32N2O12S3 and a molecular weight of 720.80 g/mol. Its IUPAC name is [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-methylthiophene-2-sulfonate.
| Compound Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-methylthiophene-2-sulfonate |
|---|---|
| PubChem CID | 175222302 |
| Molecular Formula | C31H32N2O12S3 |
| Molecular Weight | 720.80 g/mol |
| Exact Mass | 720.11 |
| IUPAC Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-methylthiophene-2-sulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(OS(=O)(=O)c4sccc4C)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H32N2O12S3/c1-17-9-12-46-29(17)48(35,36)45-30-32-33-31(44-30)47-11-8-7-10-42-28-25(34)24-20(38-3)15-19(37-2)16-21(24)43-26(28)18-13-22(39-4)27(41-6)23(14-18)40-5/h9,12-16H,7-8,10-11H2,1-6H3 |
| InChIKey | UMEGZFXPOJRQAF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.80 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|