C31H30N2O12S2 — CID 175222303
[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl] benzenesulfonate (PubChem CID 175222303) has the molecular formula C31H30N2O12S2 and a molecular weight of 686.72 g/mol. Its IUPAC name is [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl] benzenesulfonate.
| Compound Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl] benzenesulfonate |
|---|---|
| PubChem CID | 175222303 |
| Molecular Formula | C31H30N2O12S2 |
| Molecular Weight | 686.72 g/mol |
| Exact Mass | 686.12 |
| IUPAC Name | [5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl] benzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCSc3nnc(OS(=O)(=O)c4ccccc4)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H30N2O12S2/c1-37-19-16-21(38-2)25-22(17-19)43-27(18-14-23(39-3)28(41-5)24(15-18)40-4)29(26(25)34)42-12-9-13-46-31-33-32-30(44-31)45-47(35,36)20-10-7-6-8-11-20/h6-8,10-11,14-17H,9,12-13H2,1-5H3 |
| InChIKey | BOJCIZACZPDBQM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|