C23H18F4N4O4S — CID 175222594
[(7S)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7,8-dihydrofuro[2,3-g][1,3]benzothiazol-7-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 175222594) has the molecular formula C23H18F4N4O4S and a molecular weight of 522.48 g/mol. Its IUPAC name is [(7S)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7,8-dihydrofuro[2,3-g][1,3]benzothiazol-7-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(7S)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7,8-dihydrofuro[2,3-g][1,3]benzothiazol-7-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 175222594 |
| Molecular Formula | C23H18F4N4O4S |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | [(7S)-5-fluoro-2-(2-methoxy-7-methylquinoxalin-5-yl)-7,8-dihydrofuro[2,3-g][1,3]benzothiazol-7-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | COc1cnc2c(-c3nc4cc(F)c5c(c4s3)C[C@@H](COC(=O)NCC(F)(F)F)O5)cc(C)cc2n1 |
| InChI | InChI=1S/C23H18F4N4O4S/c1-10-3-12(18-15(4-10)30-17(33-2)7-28-18)21-31-16-6-14(24)19-13(20(16)36-21)5-11(35-19)8-34-22(32)29-9-23(25,26)27/h3-4,6-7,11H,5,8-9H2,1-2H3,(H,29,32)/t11-/m0/s1 |
| InChIKey | JKAKLESNKUYWAB-NSHDSACASA-N |
| XLogP | 4.95 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |