C16H21NO11S — CID 175222746
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;2-sulfobutanedioic acid (PubChem CID 175222746) has the molecular formula C16H21NO11S and a molecular weight of 435.41 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;2-sulfobutanedioic acid.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 175222746 |
| Molecular Formula | C16H21NO11S |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;2-sulfobutanedioic acid |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C(O)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H15NO4.C4H6O7S/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;5-3(6)1-2(4(7)8)12(9,10)11/h5-6,8-9H,1-4,7H2,(H,16,17);2H,1H2,(H,5,6)(H,7,8)(H,9,10,11) |
| InChIKey | NKKSCSVFCURVPG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 203.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|