C32H31FN2O12S2 — CID 175223019
[5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate (PubChem CID 175223019) has the molecular formula C32H31FN2O12S2 and a molecular weight of 718.73 g/mol. Its IUPAC name is [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate.
| Compound Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 175223019 |
| Molecular Formula | C32H31FN2O12S2 |
| Molecular Weight | 718.73 g/mol |
| Exact Mass | 718.13 |
| IUPAC Name | [5-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutylsulfanyl]-1,3,4-oxadiazol-2-yl] 3-fluorobenzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(OS(=O)(=O)c4cccc(F)c4)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H31FN2O12S2/c1-39-20-16-22(40-2)26-23(17-20)45-28(18-13-24(41-3)29(43-5)25(14-18)42-4)30(27(26)36)44-11-6-7-12-48-32-35-34-31(46-32)47-49(37,38)21-10-8-9-19(33)15-21/h8-10,13-17H,6-7,11-12H2,1-5H3 |
| InChIKey | PRFXTJQYXTXKBP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|