About 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one
3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one (PubChem CID 175223096) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one |
| PubChem CID | 175223096 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(C=C)N(C)C1=O.C=CN1CCCC1=O |
| InChI | InChI=1S/C9H13NO.C6H9NO/c1-4-7-6-8(5-2)10(3)9(7)11;1-2-7-5-3-4-6(7)8/h4-5,7-8H,1-2,6H2,3H3;2H,1,3-5H2 |
| InChIKey | FZJKFEITSAWKHF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one?
The IUPAC name of 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one (CID 175223096) is 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one.
What is the SMILES notation for 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one?
The canonical SMILES for 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one is C=CC1CC(C=C)N(C)C1=O.C=CN1CCCC1=O.
What is the InChIKey of 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one?
The InChIKey is FZJKFEITSAWKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C6H9NO/c1-4-7-6-8(5-2)10(3)9(7)11;1-2-7-5-3-4-6(7)8/h4-5,7-8H,1-2,6H2,3H3;2H,1,3-5H2.
What are the key properties of 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one?
3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one has a molecular weight of 262.35 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(ethenyl)-1-methylpyrrolidin-2-one;1-ethenylpyrrolidin-2-one is sourced from PubChem (CID 175223096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).