About 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride
2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride (PubChem CID 175223160) has the molecular formula C13H26ClNO4S
and a molecular weight of 327.87 g/mol. Its IUPAC name is 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride |
| PubChem CID | 175223160 |
| Molecular Formula | C13H26ClNO4S |
| Molecular Weight | 327.87 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride |
| SMILES | CC(C)(C)C(SCC(=O)O)C(N)(C(=O)O)C(C)(C)C.Cl |
| InChI | InChI=1S/C13H25NO4S.ClH/c1-11(2,3)9(19-7-8(15)16)13(14,10(17)18)12(4,5)6;/h9H,7,14H2,1-6H3,(H,15,16)(H,17,18);1H |
| InChIKey | WBKSNBHQYFNUBD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.87 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride?
The IUPAC name of 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride (CID 175223160) is 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride.
What is the SMILES notation for 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride?
The canonical SMILES for 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride is CC(C)(C)C(SCC(=O)O)C(N)(C(=O)O)C(C)(C)C.Cl.
What is the InChIKey of 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride?
The InChIKey is WBKSNBHQYFNUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4S.ClH/c1-11(2,3)9(19-7-8(15)16)13(14,10(17)18)12(4,5)6;/h9H,7,14H2,1-6H3,(H,15,16)(H,17,18);1H.
What are the key properties of 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride?
2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride has a molecular weight of 327.87 g/mol, XLogP of 2.47, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-tert-butyl-3-(carboxymethylsulfanyl)-4,4-dimethylpentanoic acid;hydrochloride is sourced from PubChem (CID 175223160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).