C11H13O3S- — CID 175223208
3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfinate (PubChem CID 175223208) has the molecular formula C11H13O3S- and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfinate.
| Compound Name | 3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfinate |
|---|---|
| PubChem CID | 175223208 |
| Molecular Formula | C11H13O3S- |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfinate |
| SMILES | COc1cc2c(cc1S(=O)[O-])CCCC2 |
| InChI | InChI=1S/C11H14O3S/c1-14-10-6-8-4-2-3-5-9(8)7-11(10)15(12)13/h6-7H,2-5H2,1H3,(H,12,13)/p-1 |
| InChIKey | MFMNGMMSKLCIIU-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|