About hept-4-enimidamide
hept-4-enimidamide (PubChem CID 175223434) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is hept-4-enimidamide.
Molecular Properties
| Compound Name | hept-4-enimidamide |
| PubChem CID | 175223434 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | hept-4-enimidamide |
| SMILES | [H]/N=C(/N)CCC=CCC |
| InChI | InChI=1S/C7H14N2/c1-2-3-4-5-6-7(8)9/h3-4H,2,5-6H2,1H3,(H3,8,9) |
| InChIKey | FHSCPDSYGCTTOJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-4-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-4-enimidamide?
The IUPAC name of hept-4-enimidamide (CID 175223434) is hept-4-enimidamide.
What is the SMILES notation for hept-4-enimidamide?
The canonical SMILES for hept-4-enimidamide is [H]/N=C(/N)CCC=CCC.
What is the InChIKey of hept-4-enimidamide?
The InChIKey is FHSCPDSYGCTTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-2-3-4-5-6-7(8)9/h3-4H,2,5-6H2,1H3,(H3,8,9).
What are the key properties of hept-4-enimidamide?
hept-4-enimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-4-enimidamide is sourced from PubChem (CID 175223434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).