About sulfurous acid;1,1,2,2-tetrafluoroethene
sulfurous acid;1,1,2,2-tetrafluoroethene (PubChem CID 175224566) has the molecular formula C2H2F4O3S
and a molecular weight of 182.09 g/mol. Its IUPAC name is sulfurous acid;1,1,2,2-tetrafluoroethene.
Molecular Properties
| Compound Name | sulfurous acid;1,1,2,2-tetrafluoroethene |
|---|
| PubChem CID | 175224566 |
|---|
| Molecular Formula | C2H2F4O3S |
|---|
| Molecular Weight | 182.09 g/mol |
|---|
| Exact Mass | 181.97 |
|---|
| IUPAC Name | sulfurous acid;1,1,2,2-tetrafluoroethene |
|---|
| SMILES | FC(F)=C(F)F.O=S(O)O |
|---|
| InChI | InChI=1S/C2F4.H2O3S/c3-1(4)2(5)6;1-4(2)3/h;(H2,1,2,3) |
|---|
| InChIKey | NHXRZQNEICWSCX-UHFFFAOYSA-N |
|---|
| XLogP | 1.67 |
|---|
| TPSA | 57.53 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 1 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sulfurous acid;1,1,2,2-tetrafluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfurous acid;1,1,2,2-tetrafluoroethene?
The IUPAC name of sulfurous acid;1,1,2,2-tetrafluoroethene (CID 175224566) is sulfurous acid;1,1,2,2-tetrafluoroethene.
What is the SMILES notation for sulfurous acid;1,1,2,2-tetrafluoroethene?
The canonical SMILES for sulfurous acid;1,1,2,2-tetrafluoroethene is FC(F)=C(F)F.O=S(O)O.
What is the InChIKey of sulfurous acid;1,1,2,2-tetrafluoroethene?
The InChIKey is NHXRZQNEICWSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F4.H2O3S/c3-1(4)2(5)6;1-4(2)3/h;(H2,1,2,3).
What are the key properties of sulfurous acid;1,1,2,2-tetrafluoroethene?
sulfurous acid;1,1,2,2-tetrafluoroethene has a molecular weight of 182.09 g/mol, XLogP of 1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sulfurous acid;1,1,2,2-tetrafluoroethene is sourced from PubChem (CID 175224566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).