About dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate
dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 175225755) has the molecular formula C5H5Cl2F3O3
and a molecular weight of 240.99 g/mol. Its IUPAC name is dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate.
Molecular Properties
| Compound Name | dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate |
| PubChem CID | 175225755 |
| Molecular Formula | C5H5Cl2F3O3 |
| Molecular Weight | 240.99 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | O=C(CC(O)C(F)(F)F)OC(Cl)Cl |
| InChI | InChI=1S/C5H5Cl2F3O3/c6-4(7)13-3(12)1-2(11)5(8,9)10/h2,4,11H,1H2 |
| InChIKey | VOCKTFNFWFODOO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.99 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate?
The IUPAC name of dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate (CID 175225755) is dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate.
What is the SMILES notation for dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate?
The canonical SMILES for dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate is O=C(CC(O)C(F)(F)F)OC(Cl)Cl.
What is the InChIKey of dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate?
The InChIKey is VOCKTFNFWFODOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2F3O3/c6-4(7)13-3(12)1-2(11)5(8,9)10/h2,4,11H,1H2.
What are the key properties of dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate?
dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate has a molecular weight of 240.99 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethyl 4,4,4-trifluoro-3-hydroxybutanoate is sourced from PubChem (CID 175225755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).