About 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane
4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane (PubChem CID 175225845) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane.
Molecular Properties
| Compound Name | 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane |
| PubChem CID | 175225845 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane |
| SMILES | C1=CC(C=C2CCOCC2)C=C1 |
| InChI | InChI=1S/C11H14O/c1-2-4-10(3-1)9-11-5-7-12-8-6-11/h1-4,9-10H,5-8H2 |
| InChIKey | QXPPNXXHHJMXGZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane?
The IUPAC name of 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane (CID 175225845) is 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane.
What is the SMILES notation for 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane?
The canonical SMILES for 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane is C1=CC(C=C2CCOCC2)C=C1.
What is the InChIKey of 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane?
The InChIKey is QXPPNXXHHJMXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-2-4-10(3-1)9-11-5-7-12-8-6-11/h1-4,9-10H,5-8H2.
What are the key properties of 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane?
4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane has a molecular weight of 162.23 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopenta-2,4-dien-1-ylmethylidene)oxane is sourced from PubChem (CID 175225845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).