C14H11F15O3 — CID 175225858
[1,1,1,2,2,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexan-3-yl] 2-ethylidene-4-hydroxypentanoate (PubChem CID 175225858) has the molecular formula C14H11F15O3 and a molecular weight of 512.21 g/mol. Its IUPAC name is [1,1,1,2,2,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexan-3-yl] 2-ethylidene-4-hydroxypentanoate.
| Compound Name | [1,1,1,2,2,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexan-3-yl] 2-ethylidene-4-hydroxypentanoate |
|---|---|
| PubChem CID | 175225858 |
| Molecular Formula | C14H11F15O3 |
| Molecular Weight | 512.21 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | [1,1,1,2,2,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexan-3-yl] 2-ethylidene-4-hydroxypentanoate |
| SMILES | CC=C(CC(C)O)C(=O)OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H11F15O3/c1-3-6(4-5(2)30)7(31)32-11(20,10(18,19)14(27,28)29)9(16,17)8(15,12(21,22)23)13(24,25)26/h3,5,30H,4H2,1-2H3 |
| InChIKey | PTVQCDNTMVGDOZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.21 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|