C11H11F9O3 — CID 175225878
1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl 2-ethylidene-4-hydroxypentanoate (PubChem CID 175225878) has the molecular formula C11H11F9O3 and a molecular weight of 362.19 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl 2-ethylidene-4-hydroxypentanoate.
| Compound Name | 1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl 2-ethylidene-4-hydroxypentanoate |
|---|---|
| PubChem CID | 175225878 |
| Molecular Formula | C11H11F9O3 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl 2-ethylidene-4-hydroxypentanoate |
| SMILES | CC=C(CC(C)O)C(=O)OC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9O3/c1-3-6(4-5(2)21)7(22)23-9(14,11(18,19)20)8(12,13)10(15,16)17/h3,5,21H,4H2,1-2H3 |
| InChIKey | DZADXCQMDJOAHJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|