C19H21F2NO3 — CID 175227264
6-[(E)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-2,3,4-trimethoxyaniline (PubChem CID 175227264) has the molecular formula C19H21F2NO3 and a molecular weight of 349.38 g/mol. Its IUPAC name is 6-[(E)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-2,3,4-trimethoxyaniline.
| Compound Name | 6-[(E)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-2,3,4-trimethoxyaniline |
|---|---|
| PubChem CID | 175227264 |
| Molecular Formula | C19H21F2NO3 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 6-[(E)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-2,3,4-trimethoxyaniline |
| SMILES | COc1cc(/C=C/c2ccc(C(C)(F)F)cc2)c(N)c(OC)c1OC |
| InChI | InChI=1S/C19H21F2NO3/c1-19(20,21)14-9-6-12(7-10-14)5-8-13-11-15(23-2)17(24-3)18(25-4)16(13)22/h5-11H,22H2,1-4H3/b8-5+ |
| InChIKey | RCCIOINDDKLFPB-VMPITWQZSA-N |
| XLogP | 4.58 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|