C25H27NO — CID 175227586
2-(4-methoxy-3-phenylphenyl)-1,1,3-trimethyl-2,3-dihydroinden-5-amine (PubChem CID 175227586) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-(4-methoxy-3-phenylphenyl)-1,1,3-trimethyl-2,3-dihydroinden-5-amine.
| Compound Name | 2-(4-methoxy-3-phenylphenyl)-1,1,3-trimethyl-2,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 175227586 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-(4-methoxy-3-phenylphenyl)-1,1,3-trimethyl-2,3-dihydroinden-5-amine |
| SMILES | COc1ccc(C2C(C)c3cc(N)ccc3C2(C)C)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-16-20-15-19(26)11-12-22(20)25(2,3)24(16)18-10-13-23(27-4)21(14-18)17-8-6-5-7-9-17/h5-16,24H,26H2,1-4H3 |
| InChIKey | OKHTWXQWVQGUHQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|