About 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid
1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid (PubChem CID 175227738) has the molecular formula C13H16BrFN2O3S
and a molecular weight of 379.25 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid |
| PubChem CID | 175227738 |
| Molecular Formula | C13H16BrFN2O3S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid |
| SMILES | Cc1ccccc1S(=O)(=O)O.Fc1cccc(Br)c1.NN |
| InChI | InChI=1S/C7H8O3S.C6H4BrF.H4N2/c1-6-4-2-3-5-7(6)11(8,9)10;7-5-2-1-3-6(8)4-5;1-2/h2-5H,1H3,(H,8,9,10);1-4H;1-2H2 |
| InChIKey | AQORZCRUNLXXCB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid?
The IUPAC name of 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid (CID 175227738) is 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid.
What is the SMILES notation for 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid?
The canonical SMILES for 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid is Cc1ccccc1S(=O)(=O)O.Fc1cccc(Br)c1.NN.
What is the InChIKey of 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid?
The InChIKey is AQORZCRUNLXXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H4BrF.H4N2/c1-6-4-2-3-5-7(6)11(8,9)10;7-5-2-1-3-6(8)4-5;1-2/h2-5H,1H3,(H,8,9,10);1-4H;1-2H2.
What are the key properties of 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid?
1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid has a molecular weight of 379.25 g/mol, XLogP of 2.65, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-fluorobenzene;hydrazine;2-methylbenzenesulfonic acid is sourced from PubChem (CID 175227738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).