About sodium;hydride;trimethylsilyl 2-oxopropanoate
sodium;hydride;trimethylsilyl 2-oxopropanoate (PubChem CID 175228090) has the molecular formula C6H13NaO3Si
and a molecular weight of 184.24 g/mol. Its IUPAC name is sodium;hydride;trimethylsilyl 2-oxopropanoate.
Molecular Properties
| Compound Name | sodium;hydride;trimethylsilyl 2-oxopropanoate |
| PubChem CID | 175228090 |
| Molecular Formula | C6H13NaO3Si |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | sodium;hydride;trimethylsilyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)O[Si](C)(C)C.[H-].[Na+] |
| InChI | InChI=1S/C6H12O3Si.Na.H/c1-5(7)6(8)9-10(2,3)4;;/h1-4H3;;/q;+1;-1 |
| InChIKey | AVXATYVYZMMUTH-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;trimethylsilyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;trimethylsilyl 2-oxopropanoate?
The IUPAC name of sodium;hydride;trimethylsilyl 2-oxopropanoate (CID 175228090) is sodium;hydride;trimethylsilyl 2-oxopropanoate.
What is the SMILES notation for sodium;hydride;trimethylsilyl 2-oxopropanoate?
The canonical SMILES for sodium;hydride;trimethylsilyl 2-oxopropanoate is CC(=O)C(=O)O[Si](C)(C)C.[H-].[Na+].
What is the InChIKey of sodium;hydride;trimethylsilyl 2-oxopropanoate?
The InChIKey is AVXATYVYZMMUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3Si.Na.H/c1-5(7)6(8)9-10(2,3)4;;/h1-4H3;;/q;+1;-1.
What are the key properties of sodium;hydride;trimethylsilyl 2-oxopropanoate?
sodium;hydride;trimethylsilyl 2-oxopropanoate has a molecular weight of 184.24 g/mol, XLogP of -1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;trimethylsilyl 2-oxopropanoate is sourced from PubChem (CID 175228090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).