About trimethylsilyl 2-oxopropaneperoxoate
trimethylsilyl 2-oxopropaneperoxoate (PubChem CID 175228093) has the molecular formula C6H12O4Si
and a molecular weight of 176.24 g/mol. Its IUPAC name is trimethylsilyl 2-oxopropaneperoxoate.
Molecular Properties
| Compound Name | trimethylsilyl 2-oxopropaneperoxoate |
| PubChem CID | 175228093 |
| Molecular Formula | C6H12O4Si |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | trimethylsilyl 2-oxopropaneperoxoate |
| SMILES | CC(=O)C(=O)OO[Si](C)(C)C |
| InChI | InChI=1S/C6H12O4Si/c1-5(7)6(8)9-10-11(2,3)4/h1-4H3 |
| InChIKey | UOROQKRAGALYPI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2-oxopropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2-oxopropaneperoxoate?
The IUPAC name of trimethylsilyl 2-oxopropaneperoxoate (CID 175228093) is trimethylsilyl 2-oxopropaneperoxoate.
What is the SMILES notation for trimethylsilyl 2-oxopropaneperoxoate?
The canonical SMILES for trimethylsilyl 2-oxopropaneperoxoate is CC(=O)C(=O)OO[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2-oxopropaneperoxoate?
The InChIKey is UOROQKRAGALYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4Si/c1-5(7)6(8)9-10-11(2,3)4/h1-4H3.
What are the key properties of trimethylsilyl 2-oxopropaneperoxoate?
trimethylsilyl 2-oxopropaneperoxoate has a molecular weight of 176.24 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2-oxopropaneperoxoate is sourced from PubChem (CID 175228093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).