C12H13F3N4O4 — CID 175229079
[1,7-diamino-3-cyano-6-(dimethylamino)-1,7-dioxohepta-3,5-dien-2-yl] 2,2,2-trifluoroacetate (PubChem CID 175229079) has the molecular formula C12H13F3N4O4 and a molecular weight of 334.25 g/mol. Its IUPAC name is [1,7-diamino-3-cyano-6-(dimethylamino)-1,7-dioxohepta-3,5-dien-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1,7-diamino-3-cyano-6-(dimethylamino)-1,7-dioxohepta-3,5-dien-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175229079 |
| Molecular Formula | C12H13F3N4O4 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [1,7-diamino-3-cyano-6-(dimethylamino)-1,7-dioxohepta-3,5-dien-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN(C)C(=CC=C(C#N)C(OC(=O)C(F)(F)F)C(N)=O)C(N)=O |
| InChI | InChI=1S/C12H13F3N4O4/c1-19(2)7(9(17)20)4-3-6(5-16)8(10(18)21)23-11(22)12(13,14)15/h3-4,8H,1-2H3,(H2,17,20)(H2,18,21) |
| InChIKey | CUGTURZAOIWZAR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|