About 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one
6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (PubChem CID 175229667) has the molecular formula C15H17F3N2O2
and a molecular weight of 314.31 g/mol. Its IUPAC name is 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 175229667 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| SMILES | C[C@@]1(Cc2cc3c(c(C(F)(F)F)c2)CNC3=O)CNCCO1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-14(8-19-2-3-22-14)6-9-4-10-11(7-20-13(10)21)12(5-9)15(16,17)18/h4-5,19H,2-3,6-8H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | PDLFVNQMFJCKJZ-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (CID 175229667) is 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one is C[C@@]1(Cc2cc3c(c(C(F)(F)F)c2)CNC3=O)CNCCO1.
What is the InChIKey of 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one?
The InChIKey is PDLFVNQMFJCKJZ-CQSZACIVSA-N. The full InChI is InChI=1S/C15H17F3N2O2/c1-14(8-19-2-3-22-14)6-9-4-10-11(7-20-13(10)21)12(5-9)15(16,17)18/h4-5,19H,2-3,6-8H2,1H3,(H,20,21)/t14-/m1/s1.
What are the key properties of 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one?
6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one has a molecular weight of 314.31 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2R)-2-methylmorpholin-2-yl]methyl]-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 175229667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).